C19H15N5O2S — CID 44515327
2-[6-[(4-imidazol-1-ylphenyl)methylamino]-1,3-benzothiazol-2-yl]-2-oxoacetamide (PubChem CID 44515327) has the molecular formula C19H15N5O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is 2-[6-[(4-imidazol-1-ylphenyl)methylamino]-1,3-benzothiazol-2-yl]-2-oxoacetamide.
| Compound Name | 2-[6-[(4-imidazol-1-ylphenyl)methylamino]-1,3-benzothiazol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 44515327 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[6-[(4-imidazol-1-ylphenyl)methylamino]-1,3-benzothiazol-2-yl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1nc2ccc(NCc3ccc(-n4ccnc4)cc3)cc2s1 |
| InChI | InChI=1S/C19H15N5O2S/c20-18(26)17(25)19-23-15-6-3-13(9-16(15)27-19)22-10-12-1-4-14(5-2-12)24-8-7-21-11-24/h1-9,11,22H,10H2,(H2,20,26) |
| InChIKey | CISRKTDTMSORLY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|