C16H12ClN3O2S — CID 143886127
2-[6-[(4-chlorophenyl)methylamino]-1,3-benzothiazol-2-yl]-2-oxoacetamide (PubChem CID 143886127) has the molecular formula C16H12ClN3O2S and a molecular weight of 345.81 g/mol. Its IUPAC name is 2-[6-[(4-chlorophenyl)methylamino]-1,3-benzothiazol-2-yl]-2-oxoacetamide.
| Compound Name | 2-[6-[(4-chlorophenyl)methylamino]-1,3-benzothiazol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 143886127 |
| Molecular Formula | C16H12ClN3O2S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-[6-[(4-chlorophenyl)methylamino]-1,3-benzothiazol-2-yl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1nc2ccc(NCc3ccc(Cl)cc3)cc2s1 |
| InChI | InChI=1S/C16H12ClN3O2S/c17-10-3-1-9(2-4-10)8-19-11-5-6-12-13(7-11)23-16(20-12)14(21)15(18)22/h1-7,19H,8H2,(H2,18,22) |
| InChIKey | VBYNGJIAJCUVRV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|