C15H13ClN2OS2 — CID 43682810
4-chloro-2-[[(2-methylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]phenol (PubChem CID 43682810) has the molecular formula C15H13ClN2OS2 and a molecular weight of 336.87 g/mol. Its IUPAC name is 4-chloro-2-[[(2-methylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]phenol.
| Compound Name | 4-chloro-2-[[(2-methylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 43682810 |
| Molecular Formula | C15H13ClN2OS2 |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 4-chloro-2-[[(2-methylsulfanyl-1,3-benzothiazol-6-yl)amino]methyl]phenol |
| SMILES | CSc1nc2ccc(NCc3cc(Cl)ccc3O)cc2s1 |
| InChI | InChI=1S/C15H13ClN2OS2/c1-20-15-18-12-4-3-11(7-14(12)21-15)17-8-9-6-10(16)2-5-13(9)19/h2-7,17,19H,8H2,1H3 |
| InChIKey | HHIDYSDHAIGMGW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|