C33H41ClN2O3S — CID 44515589
[2-amino-4-[(dicyclohexylamino)methyl]-5-[4-(2-methoxyethoxy)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone (PubChem CID 44515589) has the molecular formula C33H41ClN2O3S and a molecular weight of 581.22 g/mol. Its IUPAC name is [2-amino-4-[(dicyclohexylamino)methyl]-5-[4-(2-methoxyethoxy)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone.
| Compound Name | [2-amino-4-[(dicyclohexylamino)methyl]-5-[4-(2-methoxyethoxy)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 44515589 |
| Molecular Formula | C33H41ClN2O3S |
| Molecular Weight | 581.22 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | [2-amino-4-[(dicyclohexylamino)methyl]-5-[4-(2-methoxyethoxy)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
| SMILES | COCCOc1ccc(-c2sc(N)c(C(=O)c3ccc(Cl)cc3)c2CN(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C33H41ClN2O3S/c1-38-20-21-39-28-18-14-24(15-19-28)32-29(30(33(35)40-32)31(37)23-12-16-25(34)17-13-23)22-36(26-8-4-2-5-9-26)27-10-6-3-7-11-27/h12-19,26-27H,2-11,20-22,35H2,1H3 |
| InChIKey | CACHCMUDSVSMIX-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.22 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|