C31H34ClN3OS — CID 44513780
4-[5-amino-4-(4-chlorobenzoyl)-3-[(dicyclohexylamino)methyl]thiophen-2-yl]benzonitrile (PubChem CID 44513780) has the molecular formula C31H34ClN3OS and a molecular weight of 532.15 g/mol. Its IUPAC name is 4-[5-amino-4-(4-chlorobenzoyl)-3-[(dicyclohexylamino)methyl]thiophen-2-yl]benzonitrile.
| Compound Name | 4-[5-amino-4-(4-chlorobenzoyl)-3-[(dicyclohexylamino)methyl]thiophen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 44513780 |
| Molecular Formula | C31H34ClN3OS |
| Molecular Weight | 532.15 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 4-[5-amino-4-(4-chlorobenzoyl)-3-[(dicyclohexylamino)methyl]thiophen-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2sc(N)c(C(=O)c3ccc(Cl)cc3)c2CN(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C31H34ClN3OS/c32-24-17-15-22(16-18-24)29(36)28-27(30(37-31(28)34)23-13-11-21(19-33)12-14-23)20-35(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h11-18,25-26H,1-10,20,34H2 |
| InChIKey | UZRXRNVGADJIDL-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.15 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|