C32H32BrClN2O3S — CID 67212078
2-[5-bromo-3-(4-chlorobenzoyl)-4-[(dicyclohexylamino)methyl]thiophen-2-yl]isoindole-1,3-dione (PubChem CID 67212078) has the molecular formula C32H32BrClN2O3S and a molecular weight of 640.04 g/mol. Its IUPAC name is 2-[5-bromo-3-(4-chlorobenzoyl)-4-[(dicyclohexylamino)methyl]thiophen-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-bromo-3-(4-chlorobenzoyl)-4-[(dicyclohexylamino)methyl]thiophen-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67212078 |
| Molecular Formula | C32H32BrClN2O3S |
| Molecular Weight | 640.04 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | 2-[5-bromo-3-(4-chlorobenzoyl)-4-[(dicyclohexylamino)methyl]thiophen-2-yl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc(Cl)cc1)c1c(N2C(=O)c3ccccc3C2=O)sc(Br)c1CN(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C32H32BrClN2O3S/c33-29-26(19-35(22-9-3-1-4-10-22)23-11-5-2-6-12-23)27(28(37)20-15-17-21(34)18-16-20)32(40-29)36-30(38)24-13-7-8-14-25(24)31(36)39/h7-8,13-18,22-23H,1-6,9-12,19H2 |
| InChIKey | LWIHNXPZIRQWPE-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.04 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|