C32H27Cl2N3O3S — CID 71499820
2-[3-(4-chlorobenzoyl)-4-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-5-ethylthiophen-2-yl]isoindole-1,3-dione (PubChem CID 71499820) has the molecular formula C32H27Cl2N3O3S and a molecular weight of 604.56 g/mol. Its IUPAC name is 2-[3-(4-chlorobenzoyl)-4-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-5-ethylthiophen-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-(4-chlorobenzoyl)-4-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-5-ethylthiophen-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71499820 |
| Molecular Formula | C32H27Cl2N3O3S |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | 2-[3-(4-chlorobenzoyl)-4-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-5-ethylthiophen-2-yl]isoindole-1,3-dione |
| SMILES | CCc1sc(N2C(=O)c3ccccc3C2=O)c(C(=O)c2ccc(Cl)cc2)c1CN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C32H27Cl2N3O3S/c1-2-27-26(19-35-15-17-36(18-16-35)23-13-11-22(34)12-14-23)28(29(38)20-7-9-21(33)10-8-20)32(41-27)37-30(39)24-5-3-4-6-25(24)31(37)40/h3-14H,2,15-19H2,1H3 |
| InChIKey | RFJWTBWEOVXPNZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|