C31H25ClFN3O3S — CID 57433911
2-[3-(4-chlorobenzoyl)-4-[[4-(3-fluorophenyl)piperazin-1-yl]methyl]-5-methylthiophen-2-yl]isoindole-1,3-dione (PubChem CID 57433911) has the molecular formula C31H25ClFN3O3S and a molecular weight of 574.08 g/mol. Its IUPAC name is 2-[3-(4-chlorobenzoyl)-4-[[4-(3-fluorophenyl)piperazin-1-yl]methyl]-5-methylthiophen-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-(4-chlorobenzoyl)-4-[[4-(3-fluorophenyl)piperazin-1-yl]methyl]-5-methylthiophen-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 57433911 |
| Molecular Formula | C31H25ClFN3O3S |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 2-[3-(4-chlorobenzoyl)-4-[[4-(3-fluorophenyl)piperazin-1-yl]methyl]-5-methylthiophen-2-yl]isoindole-1,3-dione |
| SMILES | Cc1sc(N2C(=O)c3ccccc3C2=O)c(C(=O)c2ccc(Cl)cc2)c1CN1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C31H25ClFN3O3S/c1-19-26(18-34-13-15-35(16-14-34)23-6-4-5-22(33)17-23)27(28(37)20-9-11-21(32)12-10-20)31(40-19)36-29(38)24-7-2-3-8-25(24)30(36)39/h2-12,17H,13-16,18H2,1H3 |
| InChIKey | HXGNEHUCFBGKMC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|