C16H17BrClNOS — CID 73057373
[2-amino-5-bromo-4-(2,2-dimethylpropyl)thiophen-3-yl]-(4-chlorophenyl)methanone (PubChem CID 73057373) has the molecular formula C16H17BrClNOS and a molecular weight of 386.74 g/mol. Its IUPAC name is [2-amino-5-bromo-4-(2,2-dimethylpropyl)thiophen-3-yl]-(4-chlorophenyl)methanone.
| Compound Name | [2-amino-5-bromo-4-(2,2-dimethylpropyl)thiophen-3-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 73057373 |
| Molecular Formula | C16H17BrClNOS |
| Molecular Weight | 386.74 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | [2-amino-5-bromo-4-(2,2-dimethylpropyl)thiophen-3-yl]-(4-chlorophenyl)methanone |
| SMILES | CC(C)(C)Cc1c(Br)sc(N)c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17BrClNOS/c1-16(2,3)8-11-12(15(19)21-14(11)17)13(20)9-4-6-10(18)7-5-9/h4-7H,8,19H2,1-3H3 |
| InChIKey | DETPFBWDXTVXGW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|