C25H17ClF3NOS — CID 122188050
[2-amino-5-phenyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophen-3-yl]-(4-chlorophenyl)methanone (PubChem CID 122188050) has the molecular formula C25H17ClF3NOS and a molecular weight of 471.93 g/mol. Its IUPAC name is [2-amino-5-phenyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophen-3-yl]-(4-chlorophenyl)methanone.
| Compound Name | [2-amino-5-phenyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 122188050 |
| Molecular Formula | C25H17ClF3NOS |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | [2-amino-5-phenyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
| SMILES | Nc1sc(-c2ccccc2)c(Cc2ccc(C(F)(F)F)cc2)c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H17ClF3NOS/c26-19-12-8-16(9-13-19)22(31)21-20(14-15-6-10-18(11-7-15)25(27,28)29)23(32-24(21)30)17-4-2-1-3-5-17/h1-13H,14,30H2 |
| InChIKey | QYKWAJKHIKQCGZ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|