C22H44OSi — CID 44518239
(1-cyclohexyl-2-methylidenedodecoxy)-trimethylsilane (PubChem CID 44518239) has the molecular formula C22H44OSi and a molecular weight of 352.68 g/mol. Its IUPAC name is (1-cyclohexyl-2-methylidenedodecoxy)-trimethylsilane.
| Compound Name | (1-cyclohexyl-2-methylidenedodecoxy)-trimethylsilane |
|---|---|
| PubChem CID | 44518239 |
| Molecular Formula | C22H44OSi |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | (1-cyclohexyl-2-methylidenedodecoxy)-trimethylsilane |
| SMILES | C=C(CCCCCCCCCC)C(O[Si](C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C22H44OSi/c1-6-7-8-9-10-11-12-14-17-20(2)22(23-24(3,4)5)21-18-15-13-16-19-21/h21-22H,2,6-19H2,1,3-5H3 |
| InChIKey | DPNVCYZUAFWZDO-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|