C16H34OSi2 — CID 135067883
trimethyl-[(1R,2S)-2-[(E)-4-trimethylsilylbut-3-en-2-yl]cyclohexyl]oxysilane (PubChem CID 135067883) has the molecular formula C16H34OSi2 and a molecular weight of 298.62 g/mol. Its IUPAC name is trimethyl-[(1R,2S)-2-[(E)-4-trimethylsilylbut-3-en-2-yl]cyclohexyl]oxysilane.
| Compound Name | trimethyl-[(1R,2S)-2-[(E)-4-trimethylsilylbut-3-en-2-yl]cyclohexyl]oxysilane |
|---|---|
| PubChem CID | 135067883 |
| Molecular Formula | C16H34OSi2 |
| Molecular Weight | 298.62 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | trimethyl-[(1R,2S)-2-[(E)-4-trimethylsilylbut-3-en-2-yl]cyclohexyl]oxysilane |
| SMILES | CC(/C=C/[Si](C)(C)C)[C@@H]1CCCC[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C16H34OSi2/c1-14(12-13-18(2,3)4)15-10-8-9-11-16(15)17-19(5,6)7/h12-16H,8-11H2,1-7H3/b13-12+/t14?,15-,16+/m0/s1 |
| InChIKey | JGXLHBSHABNWQW-PDZMRMAESA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|