C15H32OSi2 — CID 135066666
trimethyl-[(E)-3-[(1S,2R)-2-trimethylsilyloxycyclohexyl]prop-2-enyl]silane (PubChem CID 135066666) has the molecular formula C15H32OSi2 and a molecular weight of 284.59 g/mol. Its IUPAC name is trimethyl-[(E)-3-[(1S,2R)-2-trimethylsilyloxycyclohexyl]prop-2-enyl]silane.
| Compound Name | trimethyl-[(E)-3-[(1S,2R)-2-trimethylsilyloxycyclohexyl]prop-2-enyl]silane |
|---|---|
| PubChem CID | 135066666 |
| Molecular Formula | C15H32OSi2 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | trimethyl-[(E)-3-[(1S,2R)-2-trimethylsilyloxycyclohexyl]prop-2-enyl]silane |
| SMILES | C[Si](C)(C)C/C=C/[C@@H]1CCCC[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C15H32OSi2/c1-17(2,3)13-9-11-14-10-7-8-12-15(14)16-18(4,5)6/h9,11,14-15H,7-8,10,12-13H2,1-6H3/b11-9+/t14-,15+/m0/s1 |
| InChIKey | OUXISVIMGGUDHS-XXQUSICCSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|