C22H30N2O8 — CID 44520125
methyl 2-[(3aR,4R,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-(phenylcarbamoylamino)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate (PubChem CID 44520125) has the molecular formula C22H30N2O8 and a molecular weight of 450.49 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-(phenylcarbamoylamino)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-(phenylcarbamoylamino)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate |
|---|---|
| PubChem CID | 44520125 |
| Molecular Formula | C22H30N2O8 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | methyl 2-[(3aR,4R,6S,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-(phenylcarbamoylamino)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate |
| SMILES | COC(=O)C[C@@]1(NC(=O)Nc2ccccc2)O[C@@H]([C@H]2COC(C)(C)O2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C22H30N2O8/c1-20(2)28-12-14(29-20)16-17-18(32-21(3,4)30-17)22(31-16,11-15(25)27-5)24-19(26)23-13-9-7-6-8-10-13/h6-10,14,16-18H,11-12H2,1-5H3,(H2,23,24,26)/t14-,16+,17-,18-,22-/m1/s1 |
| InChIKey | ODVBNPMLMUZXNJ-FFLKSDMVSA-N |
| XLogP | 2.14 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |