About oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate
oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate (PubChem CID 44520174) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate |
| PubChem CID | 44520174 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate |
| SMILES | C=C(CCC1CO1)C(=O)OCC1CO1 |
| InChI | InChI=1S/C10H14O4/c1-7(2-3-8-4-12-8)10(11)14-6-9-5-13-9/h8-9H,1-6H2 |
| InChIKey | TXEAFBOUTINSFB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate?
The IUPAC name of oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate (CID 44520174) is oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate.
What is the SMILES notation for oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate?
The canonical SMILES for oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate is C=C(CCC1CO1)C(=O)OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate?
The InChIKey is TXEAFBOUTINSFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-7(2-3-8-4-12-8)10(11)14-6-9-5-13-9/h8-9H,1-6H2.
What are the key properties of oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate?
oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate has a molecular weight of 198.22 g/mol, XLogP of 0.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 2-methylidene-4-(oxiran-2-yl)butanoate is sourced from PubChem (CID 44520174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).