C17H23NO3Si — CID 44521101
(4S)-3-[(E)-3-[dimethyl(phenyl)silyl]prop-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 44521101) has the molecular formula C17H23NO3Si and a molecular weight of 317.46 g/mol. Its IUPAC name is (4S)-3-[(E)-3-[dimethyl(phenyl)silyl]prop-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E)-3-[dimethyl(phenyl)silyl]prop-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 44521101 |
| Molecular Formula | C17H23NO3Si |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (4S)-3-[(E)-3-[dimethyl(phenyl)silyl]prop-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)/C=C/[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H23NO3Si/c1-13(2)15-12-21-17(20)18(15)16(19)10-11-22(3,4)14-8-6-5-7-9-14/h5-11,13,15H,12H2,1-4H3/b11-10+/t15-/m1/s1 |
| InChIKey | YWSBSKPMKIVBML-AUECHBEKSA-N |
| XLogP | 2.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|