About methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride
methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride (PubChem CID 44522673) has the molecular formula C21H25ClF3NO3
and a molecular weight of 431.88 g/mol. Its IUPAC name is methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride |
| PubChem CID | 44522673 |
| Molecular Formula | C21H25ClF3NO3 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(CCC(C)NCC(O)c2cccc(C(F)(F)F)c2)cc1.Cl |
| InChI | InChI=1S/C21H24F3NO3.ClH/c1-14(6-7-15-8-10-16(11-9-15)20(27)28-2)25-13-19(26)17-4-3-5-18(12-17)21(22,23)24;/h3-5,8-12,14,19,25-26H,6-7,13H2,1-2H3;1H |
| InChIKey | YOKNTLUADBPRJB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride?
The IUPAC name of methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride (CID 44522673) is methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride.
What is the SMILES notation for methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride?
The canonical SMILES for methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride is COC(=O)c1ccc(CCC(C)NCC(O)c2cccc(C(F)(F)F)c2)cc1.Cl.
What is the InChIKey of methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride?
The InChIKey is YOKNTLUADBPRJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F3NO3.ClH/c1-14(6-7-15-8-10-16(11-9-15)20(27)28-2)25-13-19(26)17-4-3-5-18(12-17)21(22,23)24;/h3-5,8-12,14,19,25-26H,6-7,13H2,1-2H3;1H.
What are the key properties of methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride?
methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride has a molecular weight of 431.88 g/mol, XLogP of 4.56, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzoate;hydrochloride is sourced from PubChem (CID 44522673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).