C16H18ClN5O — CID 44522862
2-phenyl-1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine;hydrochloride (PubChem CID 44522862) has the molecular formula C16H18ClN5O and a molecular weight of 331.81 g/mol. Its IUPAC name is 2-phenyl-1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine;hydrochloride.
| Compound Name | 2-phenyl-1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 44522862 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-phenyl-1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine;hydrochloride |
| SMILES | Cl.NC1=NC(c2ccccc2)N(OCc2ccccc2)C(N)=N1 |
| InChI | InChI=1S/C16H17N5O.ClH/c17-15-19-14(13-9-5-2-6-10-13)21(16(18)20-15)22-11-12-7-3-1-4-8-12;/h1-10,14H,11H2,(H4,17,18,19,20);1H |
| InChIKey | FSMDRVDPTWPLLQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |