C18H18ClN3O2 — CID 44523172
ethyl 4-amino-2-(4-phenylphenyl)-1H-imidazole-5-carboxylate;hydrochloride (PubChem CID 44523172) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is ethyl 4-amino-2-(4-phenylphenyl)-1H-imidazole-5-carboxylate;hydrochloride.
| Compound Name | ethyl 4-amino-2-(4-phenylphenyl)-1H-imidazole-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 44523172 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl 4-amino-2-(4-phenylphenyl)-1H-imidazole-5-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1[nH]c(-c2ccc(-c3ccccc3)cc2)nc1N.Cl |
| InChI | InChI=1S/C18H17N3O2.ClH/c1-2-23-18(22)15-16(19)21-17(20-15)14-10-8-13(9-11-14)12-6-4-3-5-7-12;/h3-11H,2,19H2,1H3,(H,20,21);1H |
| InChIKey | OFGCPCWTJADHEA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |