C18H18N6O2 — CID 44523367
3-[(3,4-dimethoxyphenyl)methyl]pyrazolo[4,5-f]quinazoline-7,9-diamine (PubChem CID 44523367) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]pyrazolo[4,5-f]quinazoline-7,9-diamine.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]pyrazolo[4,5-f]quinazoline-7,9-diamine |
|---|---|
| PubChem CID | 44523367 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]pyrazolo[4,5-f]quinazoline-7,9-diamine |
| SMILES | COc1ccc(Cn2ncc3c4c(N)nc(N)nc4ccc32)cc1OC |
| InChI | InChI=1S/C18H18N6O2/c1-25-14-6-3-10(7-15(14)26-2)9-24-13-5-4-12-16(11(13)8-21-24)17(19)23-18(20)22-12/h3-8H,9H2,1-2H3,(H4,19,20,22,23) |
| InChIKey | MHHUFJORPXSANW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |