C30H33N3O6 — CID 44523519
(Z)-but-2-enedioic acid;(E)-3-[3-[3-(dimethylamino)propyl]-4-methoxyphenyl]-N-(4-pyridin-4-ylphenyl)prop-2-enamide (PubChem CID 44523519) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(E)-3-[3-[3-(dimethylamino)propyl]-4-methoxyphenyl]-N-(4-pyridin-4-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-but-2-enedioic acid;(E)-3-[3-[3-(dimethylamino)propyl]-4-methoxyphenyl]-N-(4-pyridin-4-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44523519 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;(E)-3-[3-[3-(dimethylamino)propyl]-4-methoxyphenyl]-N-(4-pyridin-4-ylphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(-c3ccncc3)cc2)cc1CCCN(C)C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C26H29N3O2.C4H4O4/c1-29(2)18-4-5-23-19-20(6-12-25(23)31-3)7-13-26(30)28-24-10-8-21(9-11-24)22-14-16-27-17-15-22;5-3(6)1-2-4(7)8/h6-17,19H,4-5,18H2,1-3H3,(H,28,30);1-2H,(H,5,6)(H,7,8)/b13-7+;2-1- |
| InChIKey | LVFHLSJGMIVEOH-SNRZJCPWSA-N |
| XLogP | 4.62 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|