C23H16N4OS — CID 44523952
N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]pyridine-4-carboxamide (PubChem CID 44523952) has the molecular formula C23H16N4OS and a molecular weight of 396.48 g/mol. Its IUPAC name is N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 44523952 |
| Molecular Formula | C23H16N4OS |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[3-[5-(1H-benzimidazol-2-yl)thiophen-3-yl]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(-c2csc(-c3nc4ccccc4[nH]3)c2)c1)c1ccncc1 |
| InChI | InChI=1S/C23H16N4OS/c28-23(15-8-10-24-11-9-15)25-18-5-3-4-16(12-18)17-13-21(29-14-17)22-26-19-6-1-2-7-20(19)27-22/h1-14H,(H,25,28)(H,26,27) |
| InChIKey | JQRHYULDEPAETK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |