C19H15FN4O2S — CID 44525310
5-(3-fluorophenyl)-3-(6-methylsulfonyl-1H-benzimidazol-2-yl)pyridin-2-amine (PubChem CID 44525310) has the molecular formula C19H15FN4O2S and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-3-(6-methylsulfonyl-1H-benzimidazol-2-yl)pyridin-2-amine.
| Compound Name | 5-(3-fluorophenyl)-3-(6-methylsulfonyl-1H-benzimidazol-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 44525310 |
| Molecular Formula | C19H15FN4O2S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 5-(3-fluorophenyl)-3-(6-methylsulfonyl-1H-benzimidazol-2-yl)pyridin-2-amine |
| SMILES | CS(=O)(=O)c1ccc2nc(-c3cc(-c4cccc(F)c4)cnc3N)[nH]c2c1 |
| InChI | InChI=1S/C19H15FN4O2S/c1-27(25,26)14-5-6-16-17(9-14)24-19(23-16)15-8-12(10-22-18(15)21)11-3-2-4-13(20)7-11/h2-10H,1H3,(H2,21,22)(H,23,24) |
| InChIKey | ZSZDKYPBPAXYNW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |