C17H24N4O — CID 44526612
6-butyl-4-N-ethyl-2-N-(4-methoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 44526612) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 6-butyl-4-N-ethyl-2-N-(4-methoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-butyl-4-N-ethyl-2-N-(4-methoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44526612 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 6-butyl-4-N-ethyl-2-N-(4-methoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCCCc1cc(NCC)nc(Nc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C17H24N4O/c1-4-6-7-14-12-16(18-5-2)21-17(20-14)19-13-8-10-15(22-3)11-9-13/h8-12H,4-7H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | FVPFBXJZDVXCHV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |