C29H36F3N5O4 — CID 44527805
(2S)-2-[[6-methyl-2-(pentan-2-ylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 44527805) has the molecular formula C29H36F3N5O4 and a molecular weight of 575.63 g/mol. Its IUPAC name is (2S)-2-[[6-methyl-2-(pentan-2-ylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[6-methyl-2-(pentan-2-ylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44527805 |
| Molecular Formula | C29H36F3N5O4 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | (2S)-2-[[6-methyl-2-(pentan-2-ylamino)pyrimidin-4-yl]amino]-N-(2-phenoxyethyl)-3-phenylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCC(C)Nc1nc(C)cc(N[C@@H](Cc2ccccc2)C(=O)NCCOc2ccccc2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H35N5O2.C2HF3O2/c1-4-11-20(2)29-27-30-21(3)18-25(32-27)31-24(19-22-12-7-5-8-13-22)26(33)28-16-17-34-23-14-9-6-10-15-23;3-2(4,5)1(6)7/h5-10,12-15,18,20,24H,4,11,16-17,19H2,1-3H3,(H,28,33)(H2,29,30,31,32);(H,6,7)/t20?,24-;/m0./s1 |
| InChIKey | HCBGWLXPNSSDJY-ZAXUKBGBSA-N |
| XLogP | 5.24 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|