C37H45F4N3O5 — CID 44528812
N-[(2S)-1-[4-(4-fluorophenoxy)piperidin-1-yl]-3-phenylpropan-2-yl]-4-(3-piperidin-1-ylpropoxy)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 44528812) has the molecular formula C37H45F4N3O5 and a molecular weight of 687.78 g/mol. Its IUPAC name is N-[(2S)-1-[4-(4-fluorophenoxy)piperidin-1-yl]-3-phenylpropan-2-yl]-4-(3-piperidin-1-ylpropoxy)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2S)-1-[4-(4-fluorophenoxy)piperidin-1-yl]-3-phenylpropan-2-yl]-4-(3-piperidin-1-ylpropoxy)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44528812 |
| Molecular Formula | C37H45F4N3O5 |
| Molecular Weight | 687.78 g/mol |
| Exact Mass | 687.33 |
| IUPAC Name | N-[(2S)-1-[4-(4-fluorophenoxy)piperidin-1-yl]-3-phenylpropan-2-yl]-4-(3-piperidin-1-ylpropoxy)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)CN1CCC(Oc2ccc(F)cc2)CC1)c1ccc(OCCCN2CCCCC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C35H44FN3O3.C2HF3O2/c36-30-12-16-33(17-13-30)42-34-18-23-39(24-19-34)27-31(26-28-8-3-1-4-9-28)37-35(40)29-10-14-32(15-11-29)41-25-7-22-38-20-5-2-6-21-38;3-2(4,5)1(6)7/h1,3-4,8-17,31,34H,2,5-7,18-27H2,(H,37,40);(H,6,7)/t31-;/m0./s1 |
| InChIKey | VASJRANFRJERDP-YNMZEGNTSA-N |
| XLogP | 6.60 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.78 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|