C32H43FN4O — CID 44528908
1-[1-(4-fluorophenyl)-2-[4-(3-naphthalen-2-yloxypropyl)piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine (PubChem CID 44528908) has the molecular formula C32H43FN4O and a molecular weight of 518.72 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-2-[4-(3-naphthalen-2-yloxypropyl)piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[1-(4-fluorophenyl)-2-[4-(3-naphthalen-2-yloxypropyl)piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 44528908 |
| Molecular Formula | C32H43FN4O |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-2-[4-(3-naphthalen-2-yloxypropyl)piperazin-1-yl]ethyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(C(CN2CCN(CCCOc3ccc4ccccc4c3)CC2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H43FN4O/c1-26(2)36-19-21-37(22-20-36)32(28-8-11-30(33)12-9-28)25-35-17-15-34(16-18-35)14-5-23-38-31-13-10-27-6-3-4-7-29(27)24-31/h3-4,6-13,24,26,32H,5,14-23,25H2,1-2H3 |
| InChIKey | MEJKIBRHTNWGNT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|