C29H30F3N9O6 — CID 44529694
1-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]phenyl]-3-(3-methoxyphenyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 44529694) has the molecular formula C29H30F3N9O6 and a molecular weight of 657.61 g/mol. Its IUPAC name is 1-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]phenyl]-3-(3-methoxyphenyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]phenyl]-3-(3-methoxyphenyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44529694 |
| Molecular Formula | C29H30F3N9O6 |
| Molecular Weight | 657.61 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 1-[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]phenyl]-3-(3-methoxyphenyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | CCn1c(-c2nonc2N)nc2c(-c3cccc(NC(=O)Nc4cccc(OC)c4)c3)ncc(OCCCN)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H29N9O4.C2HF3O2/c1-3-36-24-20(39-12-6-11-28)15-30-21(22(24)33-26(36)23-25(29)35-40-34-23)16-7-4-8-17(13-16)31-27(37)32-18-9-5-10-19(14-18)38-2;3-2(4,5)1(6)7/h4-5,7-10,13-15H,3,6,11-12,28H2,1-2H3,(H2,29,35)(H2,31,32,37);(H,6,7) |
| InChIKey | RJWUOVSHMFMVOJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 218.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|