C21H22F3N7O3 — CID 69299663
4-[1-(5-aminopentyl)-4-phenylimidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 69299663) has the molecular formula C21H22F3N7O3 and a molecular weight of 477.45 g/mol. Its IUPAC name is 4-[1-(5-aminopentyl)-4-phenylimidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[1-(5-aminopentyl)-4-phenylimidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69299663 |
| Molecular Formula | C21H22F3N7O3 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-[1-(5-aminopentyl)-4-phenylimidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | NCCCCCn1c(-c2nonc2N)nc2c(-c3ccccc3)nccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N7O.C2HF3O2/c20-10-5-2-6-12-26-14-9-11-22-15(13-7-3-1-4-8-13)16(14)23-19(26)17-18(21)25-27-24-17;3-2(4,5)1(6)7/h1,3-4,7-9,11H,2,5-6,10,12,20H2,(H2,21,25);(H,6,7) |
| InChIKey | OYHBTENGOWXPIF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|