C30H30F3N7O5 — CID 69298343
[4-[2-[4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-4-phenylimidazo[4,5-c]pyridin-7-yl]oxybutylamino]ethyl]-2-hydroxyphenyl] 2,2,2-trifluoroacetate (PubChem CID 69298343) has the molecular formula C30H30F3N7O5 and a molecular weight of 625.61 g/mol. Its IUPAC name is [4-[2-[4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-4-phenylimidazo[4,5-c]pyridin-7-yl]oxybutylamino]ethyl]-2-hydroxyphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[2-[4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-4-phenylimidazo[4,5-c]pyridin-7-yl]oxybutylamino]ethyl]-2-hydroxyphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69298343 |
| Molecular Formula | C30H30F3N7O5 |
| Molecular Weight | 625.61 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | [4-[2-[4-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-4-phenylimidazo[4,5-c]pyridin-7-yl]oxybutylamino]ethyl]-2-hydroxyphenyl] 2,2,2-trifluoroacetate |
| SMILES | CCn1c(-c2nonc2N)nc2c(-c3ccccc3)ncc(OCCCCNCCc3ccc(OC(=O)C(F)(F)F)c(O)c3)c21 |
| InChI | InChI=1S/C30H30F3N7O5/c1-2-40-26-22(17-36-23(19-8-4-3-5-9-19)24(26)37-28(40)25-27(34)39-45-38-25)43-15-7-6-13-35-14-12-18-10-11-21(20(41)16-18)44-29(42)30(31,32)33/h3-5,8-11,16-17,35,41H,2,6-7,12-15H2,1H3,(H2,34,39) |
| InChIKey | CRXXCTRCJRBREE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|