C30H42F3N3O3 — CID 44530050
4-[(4-hexyl-1,4-diazepan-1-yl)methyl]-N-(4-propan-2-ylphenyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 44530050) has the molecular formula C30H42F3N3O3 and a molecular weight of 549.68 g/mol. Its IUPAC name is 4-[(4-hexyl-1,4-diazepan-1-yl)methyl]-N-(4-propan-2-ylphenyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(4-hexyl-1,4-diazepan-1-yl)methyl]-N-(4-propan-2-ylphenyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44530050 |
| Molecular Formula | C30H42F3N3O3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | 4-[(4-hexyl-1,4-diazepan-1-yl)methyl]-N-(4-propan-2-ylphenyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCN1CCCN(Cc2ccc(C(=O)Nc3ccc(C(C)C)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H41N3O.C2HF3O2/c1-4-5-6-7-17-30-18-8-19-31(21-20-30)22-24-9-11-26(12-10-24)28(32)29-27-15-13-25(14-16-27)23(2)3;3-2(4,5)1(6)7/h9-16,23H,4-8,17-22H2,1-3H3,(H,29,32);(H,6,7) |
| InChIKey | JKZSMDUMZIZNRP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|