C30H36F3N3O3 — CID 44536806
N-[3-[(4-pentyl-1,4-diazepan-1-yl)methyl]phenyl]naphthalene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44536806) has the molecular formula C30H36F3N3O3 and a molecular weight of 543.63 g/mol. Its IUPAC name is N-[3-[(4-pentyl-1,4-diazepan-1-yl)methyl]phenyl]naphthalene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[(4-pentyl-1,4-diazepan-1-yl)methyl]phenyl]naphthalene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536806 |
| Molecular Formula | C30H36F3N3O3 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | N-[3-[(4-pentyl-1,4-diazepan-1-yl)methyl]phenyl]naphthalene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCN1CCCN(Cc2cccc(NC(=O)c3ccc4ccccc4c3)c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H35N3O.C2HF3O2/c1-2-3-6-15-30-16-8-17-31(19-18-30)22-23-9-7-12-27(20-23)29-28(32)26-14-13-24-10-4-5-11-25(24)21-26;3-2(4,5)1(6)7/h4-5,7,9-14,20-21H,2-3,6,8,15-19,22H2,1H3,(H,29,32);(H,6,7) |
| InChIKey | NRYJDLHZDLVQEE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|