C12H10N4O — CID 44530976
5-(1-benzofuran-2-yl)pyrimidine-2,4-diamine (PubChem CID 44530976) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-(1-benzofuran-2-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44530976 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 5-(1-benzofuran-2-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cc3ccccc3o2)c(N)n1 |
| InChI | InChI=1S/C12H10N4O/c13-11-8(6-15-12(14)16-11)10-5-7-3-1-2-4-9(7)17-10/h1-6H,(H4,13,14,15,16) |
| InChIKey | SZNFPAGZWGCWSP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |