C9H7BrClN5 — CID 44531118
6-(3-bromo-4-chlorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 44531118) has the molecular formula C9H7BrClN5 and a molecular weight of 300.55 g/mol. Its IUPAC name is 6-(3-bromo-4-chlorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(3-bromo-4-chlorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 44531118 |
| Molecular Formula | C9H7BrClN5 |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | 6-(3-bromo-4-chlorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nnc(-c2ccc(Cl)c(Br)c2)c(N)n1 |
| InChI | InChI=1S/C9H7BrClN5/c10-5-3-4(1-2-6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16) |
| InChIKey | IMVUDEYWOIFLNC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |