C9H7BrN4 — CID 86676114
6-bromo-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 86676114) has the molecular formula C9H7BrN4 and a molecular weight of 251.09 g/mol. Its IUPAC name is 6-bromo-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-bromo-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 86676114 |
| Molecular Formula | C9H7BrN4 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 6-bromo-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(Br)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H7BrN4/c10-8-7(12-9(11)14-13-8)6-4-2-1-3-5-6/h1-5H,(H2,11,12,14) |
| InChIKey | HDABPGYKVQWCNG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |