C35H33ClN4O2 — CID 44531642
N,N'-bis(6-methoxy-2-phenylquinolin-4-yl)propane-1,3-diamine;hydrochloride (PubChem CID 44531642) has the molecular formula C35H33ClN4O2 and a molecular weight of 577.13 g/mol. Its IUPAC name is N,N'-bis(6-methoxy-2-phenylquinolin-4-yl)propane-1,3-diamine;hydrochloride.
| Compound Name | N,N'-bis(6-methoxy-2-phenylquinolin-4-yl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 44531642 |
| Molecular Formula | C35H33ClN4O2 |
| Molecular Weight | 577.13 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | N,N'-bis(6-methoxy-2-phenylquinolin-4-yl)propane-1,3-diamine;hydrochloride |
| SMILES | COc1ccc2nc(-c3ccccc3)cc(NCCCNc3cc(-c4ccccc4)nc4ccc(OC)cc34)c2c1.Cl |
| InChI | InChI=1S/C35H32N4O2.ClH/c1-40-26-14-16-30-28(20-26)34(22-32(38-30)24-10-5-3-6-11-24)36-18-9-19-37-35-23-33(25-12-7-4-8-13-25)39-31-17-15-27(41-2)21-29(31)35;/h3-8,10-17,20-23H,9,18-19H2,1-2H3,(H,36,38)(H,37,39);1H |
| InChIKey | NKGWPNXIXFXUPP-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.13 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|