C33H44N2O7S — CID 44531706
N,N'-bis[(2,3-dimethoxynaphthalen-1-yl)methyl]hexane-1,6-diamine;methanesulfonic acid (PubChem CID 44531706) has the molecular formula C33H44N2O7S and a molecular weight of 612.79 g/mol. Its IUPAC name is N,N'-bis[(2,3-dimethoxynaphthalen-1-yl)methyl]hexane-1,6-diamine;methanesulfonic acid.
| Compound Name | N,N'-bis[(2,3-dimethoxynaphthalen-1-yl)methyl]hexane-1,6-diamine;methanesulfonic acid |
|---|---|
| PubChem CID | 44531706 |
| Molecular Formula | C33H44N2O7S |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | N,N'-bis[(2,3-dimethoxynaphthalen-1-yl)methyl]hexane-1,6-diamine;methanesulfonic acid |
| SMILES | COc1cc2ccccc2c(CNCCCCCCNCc2c(OC)c(OC)cc3ccccc23)c1OC.CS(=O)(=O)O |
| InChI | InChI=1S/C32H40N2O4.CH4O3S/c1-35-29-19-23-13-7-9-15-25(23)27(31(29)37-3)21-33-17-11-5-6-12-18-34-22-28-26-16-10-8-14-24(26)20-30(36-2)32(28)38-4;1-5(2,3)4/h7-10,13-16,19-20,33-34H,5-6,11-12,17-18,21-22H2,1-4H3;1H3,(H,2,3,4) |
| InChIKey | CKOADSJDTUWOFC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|