C21H25NO — CID 11404042
6-(anthracen-9-ylmethylamino)hexan-1-ol (PubChem CID 11404042) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 6-(anthracen-9-ylmethylamino)hexan-1-ol.
| Compound Name | 6-(anthracen-9-ylmethylamino)hexan-1-ol |
|---|---|
| PubChem CID | 11404042 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 6-(anthracen-9-ylmethylamino)hexan-1-ol |
| SMILES | OCCCCCCNCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C21H25NO/c23-14-8-2-1-7-13-22-16-21-19-11-5-3-9-17(19)15-18-10-4-6-12-20(18)21/h3-6,9-12,15,22-23H,1-2,7-8,13-14,16H2 |
| InChIKey | WVSCUTZNLRHZCP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|