C39H42N4O2 — CID 44532824
4-(4-cyanophenyl)-N-[4-[4-[1-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]benzamide (PubChem CID 44532824) has the molecular formula C39H42N4O2 and a molecular weight of 598.79 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-[4-[4-[1-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-(4-cyanophenyl)-N-[4-[4-[1-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44532824 |
| Molecular Formula | C39H42N4O2 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 4-(4-cyanophenyl)-N-[4-[4-[1-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]benzamide |
| SMILES | N#Cc1ccc(-c2ccc(C(=O)NCCCCN3CCC(c4ccc5c(c4OCc4ccccn4)CCCC5)CC3)cc2)cc1 |
| InChI | InChI=1S/C39H42N4O2/c40-27-29-10-12-30(13-11-29)31-14-16-34(17-15-31)39(44)42-23-5-6-24-43-25-20-33(21-26-43)37-19-18-32-7-1-2-9-36(32)38(37)45-28-35-8-3-4-22-41-35/h3-4,8,10-19,22,33H,1-2,5-7,9,20-21,23-26,28H2,(H,42,44) |
| InChIKey | HFEMKUXMTRSBSH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|