C34H40F3N3O3 — CID 44532939
N-[4-[4-[2,5-dimethyl-4-[2-(methylamino)-2-oxoethoxy]phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 44532939) has the molecular formula C34H40F3N3O3 and a molecular weight of 595.71 g/mol. Its IUPAC name is N-[4-[4-[2,5-dimethyl-4-[2-(methylamino)-2-oxoethoxy]phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-[2,5-dimethyl-4-[2-(methylamino)-2-oxoethoxy]phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 44532939 |
| Molecular Formula | C34H40F3N3O3 |
| Molecular Weight | 595.71 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | N-[4-[4-[2,5-dimethyl-4-[2-(methylamino)-2-oxoethoxy]phenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CNC(=O)COc1cc(C)c(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CC2)cc1C |
| InChI | InChI=1S/C34H40F3N3O3/c1-23-21-31(43-22-32(41)38-3)24(2)20-30(23)27-14-18-40(19-15-27)17-5-4-16-39-33(42)28-8-6-25(7-9-28)26-10-12-29(13-11-26)34(35,36)37/h6-13,20-21,27H,4-5,14-19,22H2,1-3H3,(H,38,41)(H,39,42) |
| InChIKey | QMZVZVFIMZERIV-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.71 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|