C22H22N2O5 — CID 44533059
3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-phenoxy-1H-indole;oxalic acid (PubChem CID 44533059) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-phenoxy-1H-indole;oxalic acid.
| Compound Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-phenoxy-1H-indole;oxalic acid |
|---|---|
| PubChem CID | 44533059 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-phenoxy-1H-indole;oxalic acid |
| SMILES | CN1CC=C(c2c[nH]c3ccc(Oc4ccccc4)cc23)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H20N2O.C2H2O4/c1-22-11-9-15(10-12-22)19-14-21-20-8-7-17(13-18(19)20)23-16-5-3-2-4-6-16;3-1(4)2(5)6/h2-9,13-14,21H,10-12H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ZDJQHBLNZMXQMD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|