1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid

C14H17NO5 — CID 71345759

IUPAC1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid
SMILESCN1CC=C(Oc2ccccc2)CC1.O=C(O)C(=O)O
InChIInChI=1S/C12H15NO.C2H2O4/c1-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11;3-1(4)2(5)6/h2-7H,8-10H2,1H3;(H,3,4)(H,5,6)
InChIKeyWVFJOLOOFGTCQV-UHFFFAOYSA-N
MW279.29 g/mol
LogP1.44
Rot. Bonds2

About 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid

1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid (PubChem CID 71345759) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid.

Molecular Properties

Compound Name1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid
PubChem CID71345759
Molecular FormulaC14H17NO5
Molecular Weight279.29 g/mol
Exact Mass279.11
IUPAC Name1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid
SMILESCN1CC=C(Oc2ccccc2)CC1.O=C(O)C(=O)O
InChIInChI=1S/C12H15NO.C2H2O4/c1-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11;3-1(4)2(5)6/h2-7H,8-10H2,1H3;(H,3,4)(H,5,6)
InChIKeyWVFJOLOOFGTCQV-UHFFFAOYSA-N
XLogP1.44
TPSA87.07 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.29
LogP ≤ 51.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid?
The IUPAC name of 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid (CID 71345759) is 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid.
What is the SMILES notation for 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid?
The canonical SMILES for 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid is CN1CC=C(Oc2ccccc2)CC1.O=C(O)C(=O)O.
What is the InChIKey of 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid?
The InChIKey is WVFJOLOOFGTCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.C2H2O4/c1-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11;3-1(4)2(5)6/h2-7H,8-10H2,1H3;(H,3,4)(H,5,6).
What are the key properties of 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid?
1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid has a molecular weight of 279.29 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid is sourced from PubChem (CID 71345759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).