C14H17NO5 — CID 71345759
1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid (PubChem CID 71345759) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid.
| Compound Name | 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid |
|---|---|
| PubChem CID | 71345759 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-methyl-4-phenoxy-3,6-dihydro-2H-pyridine;oxalic acid |
| SMILES | CN1CC=C(Oc2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H15NO.C2H2O4/c1-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11;3-1(4)2(5)6/h2-7H,8-10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | WVFJOLOOFGTCQV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|