C25H24FNO6 — CID 70595167
(E)-2-[1-(4-fluorophenyl)-1-oxo-4-(4-phenoxy-3,6-dihydro-2H-pyridin-1-yl)butan-2-yl]but-2-enedioic acid (PubChem CID 70595167) has the molecular formula C25H24FNO6 and a molecular weight of 453.47 g/mol. Its IUPAC name is (E)-2-[1-(4-fluorophenyl)-1-oxo-4-(4-phenoxy-3,6-dihydro-2H-pyridin-1-yl)butan-2-yl]but-2-enedioic acid.
| Compound Name | (E)-2-[1-(4-fluorophenyl)-1-oxo-4-(4-phenoxy-3,6-dihydro-2H-pyridin-1-yl)butan-2-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 70595167 |
| Molecular Formula | C25H24FNO6 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (E)-2-[1-(4-fluorophenyl)-1-oxo-4-(4-phenoxy-3,6-dihydro-2H-pyridin-1-yl)butan-2-yl]but-2-enedioic acid |
| SMILES | O=C(O)/C=C(/C(=O)O)C(CCN1CC=C(Oc2ccccc2)CC1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FNO6/c26-18-8-6-17(7-9-18)24(30)21(22(25(31)32)16-23(28)29)12-15-27-13-10-20(11-14-27)33-19-4-2-1-3-5-19/h1-10,16,21H,11-15H2,(H,28,29)(H,31,32)/b22-16+ |
| InChIKey | HDCYAHCORQZRTH-CJLVFECKSA-N |
| XLogP | 3.78 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|