C29H29F3N2O5 — CID 86738025
oxalic acid;N-phenyl-N-[3-[4-[3-(trifluoromethyl)phenoxy]-3,6-dihydro-2H-pyridin-1-yl]propyl]aniline (PubChem CID 86738025) has the molecular formula C29H29F3N2O5 and a molecular weight of 542.55 g/mol. Its IUPAC name is oxalic acid;N-phenyl-N-[3-[4-[3-(trifluoromethyl)phenoxy]-3,6-dihydro-2H-pyridin-1-yl]propyl]aniline.
| Compound Name | oxalic acid;N-phenyl-N-[3-[4-[3-(trifluoromethyl)phenoxy]-3,6-dihydro-2H-pyridin-1-yl]propyl]aniline |
|---|---|
| PubChem CID | 86738025 |
| Molecular Formula | C29H29F3N2O5 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | oxalic acid;N-phenyl-N-[3-[4-[3-(trifluoromethyl)phenoxy]-3,6-dihydro-2H-pyridin-1-yl]propyl]aniline |
| SMILES | FC(F)(F)c1cccc(OC2=CCN(CCCN(c3ccccc3)c3ccccc3)CC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H27F3N2O.C2H2O4/c28-27(29,30)22-9-7-14-26(21-22)33-25-15-19-31(20-16-25)17-8-18-32(23-10-3-1-4-11-23)24-12-5-2-6-13-24;3-1(4)2(5)6/h1-7,9-15,21H,8,16-20H2;(H,3,4)(H,5,6) |
| InChIKey | BLCWWHWTPKEDCX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|