C13H11F3N2O2 — CID 135128755
6-[3-(trifluoromethyl)phenoxy]-3,4-dihydropyridine-2-carboxamide (PubChem CID 135128755) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)phenoxy]-3,4-dihydropyridine-2-carboxamide.
| Compound Name | 6-[3-(trifluoromethyl)phenoxy]-3,4-dihydropyridine-2-carboxamide |
|---|---|
| PubChem CID | 135128755 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 6-[3-(trifluoromethyl)phenoxy]-3,4-dihydropyridine-2-carboxamide |
| SMILES | NC(=O)C1=NC(Oc2cccc(C(F)(F)F)c2)=CCC1 |
| InChI | InChI=1S/C13H11F3N2O2/c14-13(15,16)8-3-1-4-9(7-8)20-11-6-2-5-10(18-11)12(17)19/h1,3-4,6-7H,2,5H2,(H2,17,19) |
| InChIKey | DRKGHDYXFLNFTM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |