C36H36N6O — CID 44533969
8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-[5-(2,6-dimethyl-4-pyridinyl)naphthalen-1-yl]-2,3-dihydropyrrolo[2,3-g]quinoline-1-carboxamide (PubChem CID 44533969) has the molecular formula C36H36N6O and a molecular weight of 568.73 g/mol. Its IUPAC name is 8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-[5-(2,6-dimethyl-4-pyridinyl)naphthalen-1-yl]-2,3-dihydropyrrolo[2,3-g]quinoline-1-carboxamide.
| Compound Name | 8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-[5-(2,6-dimethyl-4-pyridinyl)naphthalen-1-yl]-2,3-dihydropyrrolo[2,3-g]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 44533969 |
| Molecular Formula | C36H36N6O |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-[5-(2,6-dimethyl-4-pyridinyl)naphthalen-1-yl]-2,3-dihydropyrrolo[2,3-g]quinoline-1-carboxamide |
| SMILES | Cc1cc(-c2cccc3c(NC(=O)N4CCc5cc6nccc(N7CCN8CCC[C@H]8C7)c6cc54)cccc23)cc(C)n1 |
| InChI | InChI=1S/C36H36N6O/c1-23-18-26(19-24(2)38-23)28-7-3-9-30-29(28)8-4-10-32(30)39-36(43)42-15-12-25-20-33-31(21-35(25)42)34(11-13-37-33)41-17-16-40-14-5-6-27(40)22-41/h3-4,7-11,13,18-21,27H,5-6,12,14-17,22H2,1-2H3,(H,39,43)/t27-/m0/s1 |
| InChIKey | GEOVAMUXTPKIOO-MHZLTWQESA-N |
| XLogP | 6.95 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |