C26H28N4O2 — CID 44534228
[8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 44534228) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 44534228 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCc3cc4nccc(N5CCN6CCC[C@H]6C5)c4cc32)cc1 |
| InChI | InChI=1S/C26H28N4O2/c1-32-21-6-4-18(5-7-21)26(31)30-12-9-19-15-23-22(16-25(19)30)24(8-10-27-23)29-14-13-28-11-2-3-20(28)17-29/h4-8,10,15-16,20H,2-3,9,11-14,17H2,1H3/t20-/m0/s1 |
| InChIKey | INDHOQTZMJKQLU-FQEVSTJZSA-N |
| XLogP | 3.73 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |