C21H21BrClN3OS — CID 44534564
2-[3-[(6-bromo-1-benzothiophen-2-yl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride (PubChem CID 44534564) has the molecular formula C21H21BrClN3OS and a molecular weight of 478.84 g/mol. Its IUPAC name is 2-[3-[(6-bromo-1-benzothiophen-2-yl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride.
| Compound Name | 2-[3-[(6-bromo-1-benzothiophen-2-yl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 44534564 |
| Molecular Formula | C21H21BrClN3OS |
| Molecular Weight | 478.84 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | 2-[3-[(6-bromo-1-benzothiophen-2-yl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride |
| SMILES | Cl.O=c1cc(NCCCNCc2cc3ccc(Br)cc3s2)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H20BrN3OS.ClH/c22-15-7-6-14-10-16(27-20(14)11-15)13-23-8-3-9-24-21-12-19(26)17-4-1-2-5-18(17)25-21;/h1-2,4-7,10-12,23H,3,8-9,13H2,(H2,24,25,26);1H |
| InChIKey | LJIYKVVOCLDOAL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.84 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|