C38H46N4O2 — CID 44534962
1-(1-benzylpiperidin-4-yl)-1-[[3-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]-3-(2-phenylethyl)urea (PubChem CID 44534962) has the molecular formula C38H46N4O2 and a molecular weight of 590.81 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-1-[[3-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]-3-(2-phenylethyl)urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-1-[[3-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 44534962 |
| Molecular Formula | C38H46N4O2 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-1-[[3-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]-3-(2-phenylethyl)urea |
| SMILES | COCCNCc1ccc(-c2cccc(CN(C(=O)NCCc3ccccc3)C3CCN(Cc4ccccc4)CC3)c2)cc1 |
| InChI | InChI=1S/C38H46N4O2/c1-44-26-23-39-28-32-15-17-35(18-16-32)36-14-8-13-34(27-36)30-42(38(43)40-22-19-31-9-4-2-5-10-31)37-20-24-41(25-21-37)29-33-11-6-3-7-12-33/h2-18,27,37,39H,19-26,28-30H2,1H3,(H,40,43) |
| InChIKey | DQWFIBPRQAJNSF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|