C25H33ClN2O2 — CID 44535253
3-methyl-3-[4-[4-(4-methylphenoxy)piperidin-1-yl]butyl]-1H-indol-2-one;hydrochloride (PubChem CID 44535253) has the molecular formula C25H33ClN2O2 and a molecular weight of 429.00 g/mol. Its IUPAC name is 3-methyl-3-[4-[4-(4-methylphenoxy)piperidin-1-yl]butyl]-1H-indol-2-one;hydrochloride.
| Compound Name | 3-methyl-3-[4-[4-(4-methylphenoxy)piperidin-1-yl]butyl]-1H-indol-2-one;hydrochloride |
|---|---|
| PubChem CID | 44535253 |
| Molecular Formula | C25H33ClN2O2 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-methyl-3-[4-[4-(4-methylphenoxy)piperidin-1-yl]butyl]-1H-indol-2-one;hydrochloride |
| SMILES | Cc1ccc(OC2CCN(CCCCC3(C)C(=O)Nc4ccccc43)CC2)cc1.Cl |
| InChI | InChI=1S/C25H32N2O2.ClH/c1-19-9-11-20(12-10-19)29-21-13-17-27(18-14-21)16-6-5-15-25(2)22-7-3-4-8-23(22)26-24(25)28;/h3-4,7-12,21H,5-6,13-18H2,1-2H3,(H,26,28);1H |
| InChIKey | OQMNXRKJBCRHHV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|